About 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde
2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde (PubChem CID 106795067) has the molecular formula C8H6ClNO2S
and a molecular weight of 215.66 g/mol. Its IUPAC name is 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 106795067 |
| Molecular Formula | C8H6ClNO2S |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde |
| SMILES | C#CCCOc1nc(Cl)c(C=O)s1 |
| InChI | InChI=1S/C8H6ClNO2S/c1-2-3-4-12-8-10-7(9)6(5-11)13-8/h1,5H,3-4H2 |
| InChIKey | HRQUGTZIEVFIBL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde (CID 106795067) is 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde is C#CCCOc1nc(Cl)c(C=O)s1.
What is the InChIKey of 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde?
The InChIKey is HRQUGTZIEVFIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO2S/c1-2-3-4-12-8-10-7(9)6(5-11)13-8/h1,5H,3-4H2.
What are the key properties of 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde?
2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde has a molecular weight of 215.66 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-ynoxy-4-chloro-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 106795067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).