C13H16N2O3 — CID 106795368
3-but-3-yn-2-yloxy-2-nitro-N-propylaniline (PubChem CID 106795368) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-but-3-yn-2-yloxy-2-nitro-N-propylaniline.
| Compound Name | 3-but-3-yn-2-yloxy-2-nitro-N-propylaniline |
|---|---|
| PubChem CID | 106795368 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-but-3-yn-2-yloxy-2-nitro-N-propylaniline |
| SMILES | C#CC(C)Oc1cccc(NCCC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N2O3/c1-4-9-14-11-7-6-8-12(13(11)15(16)17)18-10(3)5-2/h2,6-8,10,14H,4,9H2,1,3H3 |
| InChIKey | ZBDHVFPZRYMKFD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|