About 9-methyldodecan-6-ol
9-methyldodecan-6-ol (PubChem CID 10679552) has the molecular formula C13H28O
and a molecular weight of 200.37 g/mol. Its IUPAC name is 9-methyldodecan-6-ol.
Molecular Properties
| Compound Name | 9-methyldodecan-6-ol |
| PubChem CID | 10679552 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | 9-methyldodecan-6-ol |
| SMILES | CCCCCC(O)CCC(C)CCC |
| InChI | InChI=1S/C13H28O/c1-4-6-7-9-13(14)11-10-12(3)8-5-2/h12-14H,4-11H2,1-3H3 |
| InChIKey | OQNUQRJLHHBVTR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-methyldodecan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyldodecan-6-ol?
The IUPAC name of 9-methyldodecan-6-ol (CID 10679552) is 9-methyldodecan-6-ol.
What is the SMILES notation for 9-methyldodecan-6-ol?
The canonical SMILES for 9-methyldodecan-6-ol is CCCCCC(O)CCC(C)CCC.
What is the InChIKey of 9-methyldodecan-6-ol?
The InChIKey is OQNUQRJLHHBVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O/c1-4-6-7-9-13(14)11-10-12(3)8-5-2/h12-14H,4-11H2,1-3H3.
What are the key properties of 9-methyldodecan-6-ol?
9-methyldodecan-6-ol has a molecular weight of 200.37 g/mol, XLogP of 4.14, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyldodecan-6-ol is sourced from PubChem (CID 10679552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).