C10H9BrF3N3 — CID 106795797
3-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-methylamino]propanenitrile (PubChem CID 106795797) has the molecular formula C10H9BrF3N3 and a molecular weight of 308.10 g/mol. Its IUPAC name is 3-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-methylamino]propanenitrile.
| Compound Name | 3-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-methylamino]propanenitrile |
|---|---|
| PubChem CID | 106795797 |
| Molecular Formula | C10H9BrF3N3 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 3-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-methylamino]propanenitrile |
| SMILES | CN(CCC#N)c1ncc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C10H9BrF3N3/c1-17(4-2-3-15)9-8(10(12,13)14)5-7(11)6-16-9/h5-6H,2,4H2,1H3 |
| InChIKey | FLKWWZUZUIRJIE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |