C12H16BrF3N4 — CID 106796604
[1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-4-methylpiperazin-2-yl]methanamine (PubChem CID 106796604) has the molecular formula C12H16BrF3N4 and a molecular weight of 353.19 g/mol. Its IUPAC name is [1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-4-methylpiperazin-2-yl]methanamine.
| Compound Name | [1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-4-methylpiperazin-2-yl]methanamine |
|---|---|
| PubChem CID | 106796604 |
| Molecular Formula | C12H16BrF3N4 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | [1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-4-methylpiperazin-2-yl]methanamine |
| SMILES | CN1CCN(c2ncc(Br)cc2C(F)(F)F)C(CN)C1 |
| InChI | InChI=1S/C12H16BrF3N4/c1-19-2-3-20(9(5-17)7-19)11-10(12(14,15)16)4-8(13)6-18-11/h4,6,9H,2-3,5,7,17H2,1H3 |
| InChIKey | TZHRMKCTGKNSIX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |