C13H16BrF3N2O — CID 106796833
5-bromo-2-(2-piperidin-3-ylethoxy)-3-(trifluoromethyl)pyridine (PubChem CID 106796833) has the molecular formula C13H16BrF3N2O and a molecular weight of 353.18 g/mol. Its IUPAC name is 5-bromo-2-(2-piperidin-3-ylethoxy)-3-(trifluoromethyl)pyridine.
| Compound Name | 5-bromo-2-(2-piperidin-3-ylethoxy)-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 106796833 |
| Molecular Formula | C13H16BrF3N2O |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 5-bromo-2-(2-piperidin-3-ylethoxy)-3-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(Br)cnc1OCCC1CCCNC1 |
| InChI | InChI=1S/C13H16BrF3N2O/c14-10-6-11(13(15,16)17)12(19-8-10)20-5-3-9-2-1-4-18-7-9/h6,8-9,18H,1-5,7H2 |
| InChIKey | HLNAUVZZEJQNEQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |