C12H13BrClF3N2 — CID 106797166
5-bromo-2-[2-(chloromethyl)-3-methylpyrrolidin-1-yl]-3-(trifluoromethyl)pyridine (PubChem CID 106797166) has the molecular formula C12H13BrClF3N2 and a molecular weight of 357.60 g/mol. Its IUPAC name is 5-bromo-2-[2-(chloromethyl)-3-methylpyrrolidin-1-yl]-3-(trifluoromethyl)pyridine.
| Compound Name | 5-bromo-2-[2-(chloromethyl)-3-methylpyrrolidin-1-yl]-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 106797166 |
| Molecular Formula | C12H13BrClF3N2 |
| Molecular Weight | 357.60 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 5-bromo-2-[2-(chloromethyl)-3-methylpyrrolidin-1-yl]-3-(trifluoromethyl)pyridine |
| SMILES | CC1CCN(c2ncc(Br)cc2C(F)(F)F)C1CCl |
| InChI | InChI=1S/C12H13BrClF3N2/c1-7-2-3-19(10(7)5-14)11-9(12(15,16)17)4-8(13)6-18-11/h4,6-7,10H,2-3,5H2,1H3 |
| InChIKey | DFSPLILBCJLZSI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|