C17H29N3 — CID 106798023
N-[1-[1-[(1-cyclopentylpyrazol-3-yl)methyl]cyclopropyl]ethyl]propan-1-amine (PubChem CID 106798023) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is N-[1-[1-[(1-cyclopentylpyrazol-3-yl)methyl]cyclopropyl]ethyl]propan-1-amine.
| Compound Name | N-[1-[1-[(1-cyclopentylpyrazol-3-yl)methyl]cyclopropyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106798023 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N-[1-[1-[(1-cyclopentylpyrazol-3-yl)methyl]cyclopropyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)C1(Cc2ccn(C3CCCC3)n2)CC1 |
| InChI | InChI=1S/C17H29N3/c1-3-11-18-14(2)17(9-10-17)13-15-8-12-20(19-15)16-6-4-5-7-16/h8,12,14,16,18H,3-7,9-11,13H2,1-2H3 |
| InChIKey | CMIMYUZTXYRDCR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |