C12H13BrClF — CID 106798672
2-[[1-(1-bromoethyl)cyclopropyl]methyl]-4-chloro-1-fluorobenzene (PubChem CID 106798672) has the molecular formula C12H13BrClF and a molecular weight of 291.59 g/mol. Its IUPAC name is 2-[[1-(1-bromoethyl)cyclopropyl]methyl]-4-chloro-1-fluorobenzene.
| Compound Name | 2-[[1-(1-bromoethyl)cyclopropyl]methyl]-4-chloro-1-fluorobenzene |
|---|---|
| PubChem CID | 106798672 |
| Molecular Formula | C12H13BrClF |
| Molecular Weight | 291.59 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2-[[1-(1-bromoethyl)cyclopropyl]methyl]-4-chloro-1-fluorobenzene |
| SMILES | CC(Br)C1(Cc2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C12H13BrClF/c1-8(13)12(4-5-12)7-9-6-10(14)2-3-11(9)15/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | WCVVDISCSUPLSO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|