About 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine
2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine (PubChem CID 10680057) has the molecular formula C7H8N4S2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine.
Analyze 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine?
The IUPAC name of 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine (CID 10680057) is 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine.
What is the SMILES notation for 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine?
The canonical SMILES for 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine is CSc1nc(SC)c2nccn2n1.
What is the InChIKey of 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine?
The InChIKey is WPAPMTKHFRWOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S2/c1-12-6-5-8-3-4-11(5)10-7(9-6)13-2/h3-4H,1-2H3.
What are the key properties of 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine?
2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine has a molecular weight of 212.30 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(methylsulfanyl)imidazo[2,1-f][1,2,4]triazine is sourced from PubChem (CID 10680057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).