C12H18N2O2 — CID 106801775
2,6-dimethyl-3-(4-oxohexyl)pyrimidin-4-one (PubChem CID 106801775) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2,6-dimethyl-3-(4-oxohexyl)pyrimidin-4-one.
| Compound Name | 2,6-dimethyl-3-(4-oxohexyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 106801775 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2,6-dimethyl-3-(4-oxohexyl)pyrimidin-4-one |
| SMILES | CCC(=O)CCCn1c(C)nc(C)cc1=O |
| InChI | InChI=1S/C12H18N2O2/c1-4-11(15)6-5-7-14-10(3)13-9(2)8-12(14)16/h8H,4-7H2,1-3H3 |
| InChIKey | SZPRKHWYRUQKIX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |