C11H16N4O2 — CID 106802579
2-(4-hydroxyhexyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 106802579) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-(4-hydroxyhexyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(4-hydroxyhexyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 106802579 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-(4-hydroxyhexyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | CCC(O)CCCn1nc2cnccn2c1=O |
| InChI | InChI=1S/C11H16N4O2/c1-2-9(16)4-3-6-15-11(17)14-7-5-12-8-10(14)13-15/h5,7-9,16H,2-4,6H2,1H3 |
| InChIKey | GMFBIMCEORUILS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |