C18H33N3 — CID 106803115
5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-ethyl-2-(ethylamino)pentanenitrile (PubChem CID 106803115) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-ethyl-2-(ethylamino)pentanenitrile.
| Compound Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-ethyl-2-(ethylamino)pentanenitrile |
|---|---|
| PubChem CID | 106803115 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-ethyl-2-(ethylamino)pentanenitrile |
| SMILES | CCNC(C#N)(CC)CCCN1CCCC2CCCCC21 |
| InChI | InChI=1S/C18H33N3/c1-3-18(15-19,20-4-2)12-8-14-21-13-7-10-16-9-5-6-11-17(16)21/h16-17,20H,3-14H2,1-2H3 |
| InChIKey | DDDNCEBGDOUERL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |