About 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol
2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol (PubChem CID 10680342) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol.
Molecular Properties
| Compound Name | 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol |
| PubChem CID | 10680342 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol |
| SMILES | C=CCC(/C=C/OCCO)c1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-2-6-13(9-11-16-12-10-15)14-7-4-3-5-8-14/h2-5,7-9,11,13,15H,1,6,10,12H2/b11-9+ |
| InChIKey | KNYWFZCRWNUIGK-PKNBQFBNSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol?
The IUPAC name of 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol (CID 10680342) is 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol.
What is the SMILES notation for 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol?
The canonical SMILES for 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol is C=CCC(/C=C/OCCO)c1ccccc1.
What is the InChIKey of 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol?
The InChIKey is KNYWFZCRWNUIGK-PKNBQFBNSA-N. The full InChI is InChI=1S/C14H18O2/c1-2-6-13(9-11-16-12-10-15)14-7-4-3-5-8-14/h2-5,7-9,11,13,15H,1,6,10,12H2/b11-9+.
What are the key properties of 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol?
2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol has a molecular weight of 218.30 g/mol, XLogP of 2.87, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-3-phenylhexa-1,5-dienoxy]ethanol is sourced from PubChem (CID 10680342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).