C17H36N4 — CID 106804047
5-[3-(dimethylamino)propyl-ethylamino]-2-ethyl-2-(propan-2-ylamino)pentanenitrile (PubChem CID 106804047) has the molecular formula C17H36N4 and a molecular weight of 296.50 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyl-ethylamino]-2-ethyl-2-(propan-2-ylamino)pentanenitrile.
| Compound Name | 5-[3-(dimethylamino)propyl-ethylamino]-2-ethyl-2-(propan-2-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 106804047 |
| Molecular Formula | C17H36N4 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.29 |
| IUPAC Name | 5-[3-(dimethylamino)propyl-ethylamino]-2-ethyl-2-(propan-2-ylamino)pentanenitrile |
| SMILES | CCN(CCCN(C)C)CCCC(C#N)(CC)NC(C)C |
| InChI | InChI=1S/C17H36N4/c1-7-17(15-18,19-16(3)4)11-9-13-21(8-2)14-10-12-20(5)6/h16,19H,7-14H2,1-6H3 |
| InChIKey | BUVHACXNEPZLHP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |