C14H20O2 — CID 10680460
(4aS,8aR)-4a,8-dimethylspiro[1,2,4,8a-tetrahydronaphthalene-3,2'-1,3-dioxolane] (PubChem CID 10680460) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (4aS,8aR)-4a,8-dimethylspiro[1,2,4,8a-tetrahydronaphthalene-3,2'-1,3-dioxolane].
| Compound Name | (4aS,8aR)-4a,8-dimethylspiro[1,2,4,8a-tetrahydronaphthalene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 10680460 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (4aS,8aR)-4a,8-dimethylspiro[1,2,4,8a-tetrahydronaphthalene-3,2'-1,3-dioxolane] |
| SMILES | CC1=CC=C[C@]2(C)CC3(CC[C@H]12)OCCO3 |
| InChI | InChI=1S/C14H20O2/c1-11-4-3-6-13(2)10-14(7-5-12(11)13)15-8-9-16-14/h3-4,6,12H,5,7-10H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | PHGLMWRRNDDRML-CHWSQXEVSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |