C11H17F5N2O — CID 106804865
2-ethyl-2-(methylamino)-5-(2,2,3,3,3-pentafluoropropoxy)pentanenitrile (PubChem CID 106804865) has the molecular formula C11H17F5N2O and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-ethyl-2-(methylamino)-5-(2,2,3,3,3-pentafluoropropoxy)pentanenitrile.
| Compound Name | 2-ethyl-2-(methylamino)-5-(2,2,3,3,3-pentafluoropropoxy)pentanenitrile |
|---|---|
| PubChem CID | 106804865 |
| Molecular Formula | C11H17F5N2O |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-ethyl-2-(methylamino)-5-(2,2,3,3,3-pentafluoropropoxy)pentanenitrile |
| SMILES | CCC(C#N)(CCCOCC(F)(F)C(F)(F)F)NC |
| InChI | InChI=1S/C11H17F5N2O/c1-3-9(7-17,18-2)5-4-6-19-8-10(12,13)11(14,15)16/h18H,3-6,8H2,1-2H3 |
| InChIKey | DIVTWMZLTRLDPG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|