C13H23N5OS — CID 106805366
2-ethyl-5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile (PubChem CID 106805366) has the molecular formula C13H23N5OS and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-ethyl-5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile.
| Compound Name | 2-ethyl-5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile |
|---|---|
| PubChem CID | 106805366 |
| Molecular Formula | C13H23N5OS |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-ethyl-5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile |
| SMILES | CCCNC(C#N)(CC)CCCSc1n[nH]c(=O)n1C |
| InChI | InChI=1S/C13H23N5OS/c1-4-8-15-13(5-2,10-14)7-6-9-20-12-17-16-11(19)18(12)3/h15H,4-9H2,1-3H3,(H,16,19) |
| InChIKey | CSMAEFRFDWMHSJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|