C13H21NS — CID 10680620
(2S)-N,N,3-trimethyl-1-phenylsulfanylbutan-2-amine (PubChem CID 10680620) has the molecular formula C13H21NS and a molecular weight of 223.39 g/mol. Its IUPAC name is (2S)-N,N,3-trimethyl-1-phenylsulfanylbutan-2-amine.
| Compound Name | (2S)-N,N,3-trimethyl-1-phenylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 10680620 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (2S)-N,N,3-trimethyl-1-phenylsulfanylbutan-2-amine |
| SMILES | CC(C)[C@@H](CSc1ccccc1)N(C)C |
| InChI | InChI=1S/C13H21NS/c1-11(2)13(14(3)4)10-15-12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3/t13-/m1/s1 |
| InChIKey | ZHIHUKJYHBZOJR-CYBMUJFWSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |