C9H16N6O — CID 10680655
6-(ethoxymethyl)-5,6,7,8-tetrahydropteridine-2,4-diamine (PubChem CID 10680655) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is 6-(ethoxymethyl)-5,6,7,8-tetrahydropteridine-2,4-diamine.
| Compound Name | 6-(ethoxymethyl)-5,6,7,8-tetrahydropteridine-2,4-diamine |
|---|---|
| PubChem CID | 10680655 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 6-(ethoxymethyl)-5,6,7,8-tetrahydropteridine-2,4-diamine |
| SMILES | CCOCC1CNc2nc(N)nc(N)c2N1 |
| InChI | InChI=1S/C9H16N6O/c1-2-16-4-5-3-12-8-6(13-5)7(10)14-9(11)15-8/h5,13H,2-4H2,1H3,(H5,10,11,12,14,15) |
| InChIKey | WVQOFYTWWHIHAI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |