C14H24O2 — CID 10680678
(2R,3S)-2-but-3-enyl-3-pent-4-enoxyoxane (PubChem CID 10680678) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (2R,3S)-2-but-3-enyl-3-pent-4-enoxyoxane.
| Compound Name | (2R,3S)-2-but-3-enyl-3-pent-4-enoxyoxane |
|---|---|
| PubChem CID | 10680678 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2R,3S)-2-but-3-enyl-3-pent-4-enoxyoxane |
| SMILES | C=CCCCO[C@H]1CCCO[C@@H]1CCC=C |
| InChI | InChI=1S/C14H24O2/c1-3-5-7-11-15-14-10-8-12-16-13(14)9-6-4-2/h3-4,13-14H,1-2,5-12H2/t13-,14+/m1/s1 |
| InChIKey | POJWDXZRLQRCBK-KGLIPLIRSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|