C10H18F3NO3 — CID 106806905
2-ethyl-2-(methylamino)-5-(2,2,2-trifluoroethoxy)pentanoic acid (PubChem CID 106806905) has the molecular formula C10H18F3NO3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-ethyl-2-(methylamino)-5-(2,2,2-trifluoroethoxy)pentanoic acid.
| Compound Name | 2-ethyl-2-(methylamino)-5-(2,2,2-trifluoroethoxy)pentanoic acid |
|---|---|
| PubChem CID | 106806905 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-ethyl-2-(methylamino)-5-(2,2,2-trifluoroethoxy)pentanoic acid |
| SMILES | CCC(CCCOCC(F)(F)F)(NC)C(=O)O |
| InChI | InChI=1S/C10H18F3NO3/c1-3-9(14-2,8(15)16)5-4-6-17-7-10(11,12)13/h14H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | BQPNRUWPSIANJW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|