About [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone
[(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 10680718) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| PubChem CID | 10680718 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | CC1=CCO[C@@]1(C)C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C12H19NO3/c1-9-5-7-16-12(9,2)11(15)13-6-3-4-10(13)8-14/h5,10,14H,3-4,6-8H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | USEUBSULYCFWCI-CMPLNLGQSA-N |
| XLogP | 0.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone?
The IUPAC name of [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone (CID 10680718) is [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone?
The canonical SMILES for [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone is CC1=CCO[C@@]1(C)C(=O)N1CCC[C@H]1CO.
What is the InChIKey of [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone?
The InChIKey is USEUBSULYCFWCI-CMPLNLGQSA-N. The full InChI is InChI=1S/C12H19NO3/c1-9-5-7-16-12(9,2)11(15)13-6-3-4-10(13)8-14/h5,10,14H,3-4,6-8H2,1-2H3/t10-,12+/m0/s1.
What are the key properties of [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone?
[(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone has a molecular weight of 225.29 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 10680718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).