C16H21NS — CID 106808319
6-naphthalen-2-ylsulfanylhexan-3-amine (PubChem CID 106808319) has the molecular formula C16H21NS and a molecular weight of 259.42 g/mol. Its IUPAC name is 6-naphthalen-2-ylsulfanylhexan-3-amine.
| Compound Name | 6-naphthalen-2-ylsulfanylhexan-3-amine |
|---|---|
| PubChem CID | 106808319 |
| Molecular Formula | C16H21NS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 6-naphthalen-2-ylsulfanylhexan-3-amine |
| SMILES | CCC(N)CCCSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H21NS/c1-2-15(17)8-5-11-18-16-10-9-13-6-3-4-7-14(13)12-16/h3-4,6-7,9-10,12,15H,2,5,8,11,17H2,1H3 |
| InChIKey | HLXSFNUZQVCRQU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|