C12H19BrN2S — CID 106808448
6-[(3-bromo-2-pyridinyl)sulfanyl]-N-methylhexan-3-amine (PubChem CID 106808448) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is 6-[(3-bromo-2-pyridinyl)sulfanyl]-N-methylhexan-3-amine.
| Compound Name | 6-[(3-bromo-2-pyridinyl)sulfanyl]-N-methylhexan-3-amine |
|---|---|
| PubChem CID | 106808448 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 6-[(3-bromo-2-pyridinyl)sulfanyl]-N-methylhexan-3-amine |
| SMILES | CCC(CCCSc1ncccc1Br)NC |
| InChI | InChI=1S/C12H19BrN2S/c1-3-10(14-2)6-5-9-16-12-11(13)7-4-8-15-12/h4,7-8,10,14H,3,5-6,9H2,1-2H3 |
| InChIKey | RWYBKDGACVHAOS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|