C12H15N5 — CID 10680927
(1R,11S)-1,14,14-trimethyl-3,5,6,7,8-pentazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,6,9-tetraene (PubChem CID 10680927) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is (1R,11S)-1,14,14-trimethyl-3,5,6,7,8-pentazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,6,9-tetraene.
| Compound Name | (1R,11S)-1,14,14-trimethyl-3,5,6,7,8-pentazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 10680927 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (1R,11S)-1,14,14-trimethyl-3,5,6,7,8-pentazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,6,9-tetraene |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)c1nc3nnnn3cc12 |
| InChI | InChI=1S/C12H15N5/c1-11(2)8-4-5-12(11,3)9-7(8)6-17-10(13-9)14-15-16-17/h6,8H,4-5H2,1-3H3/t8-,12+/m1/s1 |
| InChIKey | OBLBGTAGYXEWGX-PELKAZGASA-N |
| XLogP | 1.69 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |