About 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol
2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol (PubChem CID 106809367) has the molecular formula C15H31F3N2O
and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol |
| PubChem CID | 106809367 |
| Molecular Formula | C15H31F3N2O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(CC)(CO)CCCN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C15H31F3N2O/c1-5-9-19-14(6-2,12-21)8-7-10-20(13(3)4)11-15(16,17)18/h13,19,21H,5-12H2,1-4H3 |
| InChIKey | MCDKJSOVQBESDD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol?
The IUPAC name of 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol (CID 106809367) is 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol.
What is the SMILES notation for 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol?
The canonical SMILES for 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol is CCCNC(CC)(CO)CCCN(CC(F)(F)F)C(C)C.
What is the InChIKey of 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol?
The InChIKey is MCDKJSOVQBESDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31F3N2O/c1-5-9-19-14(6-2,12-21)8-7-10-20(13(3)4)11-15(16,17)18/h13,19,21H,5-12H2,1-4H3.
What are the key properties of 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol?
2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol has a molecular weight of 312.42 g/mol, XLogP of 3.18, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]-2-(propylamino)pentan-1-ol is sourced from PubChem (CID 106809367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).