C17H35N3O — CID 106809748
5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-ethyl-2-(propan-2-ylamino)pentan-1-ol (PubChem CID 106809748) has the molecular formula C17H35N3O and a molecular weight of 297.49 g/mol. Its IUPAC name is 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-ethyl-2-(propan-2-ylamino)pentan-1-ol.
| Compound Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-ethyl-2-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106809748 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-ethyl-2-(propan-2-ylamino)pentan-1-ol |
| SMILES | CCC(CO)(CCCN1CCN2CCCC2C1)NC(C)C |
| InChI | InChI=1S/C17H35N3O/c1-4-17(14-21,18-15(2)3)8-6-9-19-11-12-20-10-5-7-16(20)13-19/h15-16,18,21H,4-14H2,1-3H3 |
| InChIKey | FKOFSFPGLKLSBZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |