About 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine
6-chlorobenzo[h][1,2,4]benzotriazin-3-amine (PubChem CID 10681003) has the molecular formula C11H7ClN4
and a molecular weight of 230.66 g/mol. Its IUPAC name is 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine.
Molecular Properties
| Compound Name | 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine |
| PubChem CID | 10681003 |
| Molecular Formula | C11H7ClN4 |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine |
| SMILES | Nc1nnc2c(cc(Cl)c3ccccc32)n1 |
| InChI | InChI=1S/C11H7ClN4/c12-8-5-9-10(15-16-11(13)14-9)7-4-2-1-3-6(7)8/h1-5H,(H2,13,14,16) |
| InChIKey | OXOWNRMTLQYICK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine?
The IUPAC name of 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine (CID 10681003) is 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine.
What is the SMILES notation for 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine?
The canonical SMILES for 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine is Nc1nnc2c(cc(Cl)c3ccccc32)n1.
What is the InChIKey of 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine?
The InChIKey is OXOWNRMTLQYICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN4/c12-8-5-9-10(15-16-11(13)14-9)7-4-2-1-3-6(7)8/h1-5H,(H2,13,14,16).
What are the key properties of 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine?
6-chlorobenzo[h][1,2,4]benzotriazin-3-amine has a molecular weight of 230.66 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorobenzo[h][1,2,4]benzotriazin-3-amine is sourced from PubChem (CID 10681003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).