About 1,5-dinitro-1,5-diazocane-3,7-dione
1,5-dinitro-1,5-diazocane-3,7-dione (PubChem CID 10681055) has the molecular formula C6H8N4O6
and a molecular weight of 232.15 g/mol. Its IUPAC name is 1,5-dinitro-1,5-diazocane-3,7-dione.
Molecular Properties
| Compound Name | 1,5-dinitro-1,5-diazocane-3,7-dione |
| PubChem CID | 10681055 |
| Molecular Formula | C6H8N4O6 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 1,5-dinitro-1,5-diazocane-3,7-dione |
| SMILES | O=C1CN([N+](=O)[O-])CC(=O)CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C6H8N4O6/c11-5-1-7(9(13)14)3-6(12)4-8(2-5)10(15)16/h1-4H2 |
| InChIKey | UGDPQTIYSDEDAH-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dinitro-1,5-diazocane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dinitro-1,5-diazocane-3,7-dione?
The IUPAC name of 1,5-dinitro-1,5-diazocane-3,7-dione (CID 10681055) is 1,5-dinitro-1,5-diazocane-3,7-dione.
What is the SMILES notation for 1,5-dinitro-1,5-diazocane-3,7-dione?
The canonical SMILES for 1,5-dinitro-1,5-diazocane-3,7-dione is O=C1CN([N+](=O)[O-])CC(=O)CN([N+](=O)[O-])C1.
What is the InChIKey of 1,5-dinitro-1,5-diazocane-3,7-dione?
The InChIKey is UGDPQTIYSDEDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O6/c11-5-1-7(9(13)14)3-6(12)4-8(2-5)10(15)16/h1-4H2.
What are the key properties of 1,5-dinitro-1,5-diazocane-3,7-dione?
1,5-dinitro-1,5-diazocane-3,7-dione has a molecular weight of 232.15 g/mol, XLogP of -1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dinitro-1,5-diazocane-3,7-dione is sourced from PubChem (CID 10681055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).