About 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol
2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol (PubChem CID 106810681) has the molecular formula C11H22F3NO2
and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol.
Molecular Properties
| Compound Name | 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol |
| PubChem CID | 106810681 |
| Molecular Formula | C11H22F3NO2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol |
| SMILES | CCC(N)(CO)CCCOCCCC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO2/c1-2-10(15,9-16)5-3-7-17-8-4-6-11(12,13)14/h16H,2-9,15H2,1H3 |
| InChIKey | LCSVXSLXUKNSFN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol?
The IUPAC name of 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol (CID 106810681) is 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol.
What is the SMILES notation for 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol?
The canonical SMILES for 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol is CCC(N)(CO)CCCOCCCC(F)(F)F.
What is the InChIKey of 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol?
The InChIKey is LCSVXSLXUKNSFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3NO2/c1-2-10(15,9-16)5-3-7-17-8-4-6-11(12,13)14/h16H,2-9,15H2,1H3.
What are the key properties of 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol?
2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol has a molecular weight of 257.30 g/mol, XLogP of 2.23, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-ethyl-5-(4,4,4-trifluorobutoxy)pentan-1-ol is sourced from PubChem (CID 106810681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).