About 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol
2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol (PubChem CID 106810687) has the molecular formula C10H20F3NO2
and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol.
Molecular Properties
| Compound Name | 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol |
| PubChem CID | 106810687 |
| Molecular Formula | C10H20F3NO2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol |
| SMILES | CCC(N)(CO)CCCOCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2/c1-2-9(14,8-15)4-3-6-16-7-5-10(11,12)13/h15H,2-8,14H2,1H3 |
| InChIKey | SMFRERATXVVUNW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol?
The IUPAC name of 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol (CID 106810687) is 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol.
What is the SMILES notation for 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol?
The canonical SMILES for 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol is CCC(N)(CO)CCCOCCC(F)(F)F.
What is the InChIKey of 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol?
The InChIKey is SMFRERATXVVUNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO2/c1-2-9(14,8-15)4-3-6-16-7-5-10(11,12)13/h15H,2-8,14H2,1H3.
What are the key properties of 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol?
2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol has a molecular weight of 243.27 g/mol, XLogP of 1.84, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-ethyl-5-(3,3,3-trifluoropropoxy)pentan-1-ol is sourced from PubChem (CID 106810687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).