C10H17F6NO2 — CID 106810715
2-amino-2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-1-ol (PubChem CID 106810715) has the molecular formula C10H17F6NO2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-1-ol.
| Compound Name | 2-amino-2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-1-ol |
|---|---|
| PubChem CID | 106810715 |
| Molecular Formula | C10H17F6NO2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-amino-2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-1-ol |
| SMILES | CCC(N)(CO)CCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17F6NO2/c1-2-8(17,6-18)4-3-5-19-7(9(11,12)13)10(14,15)16/h7,18H,2-6,17H2,1H3 |
| InChIKey | JOVWSNJDMXUMIA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|