About 10-methylindolo[3,2-b]quinoline
10-methylindolo[3,2-b]quinoline (PubChem CID 10681089) has the molecular formula C16H12N2
and a molecular weight of 232.29 g/mol. Its IUPAC name is 10-methylindolo[3,2-b]quinoline.
Molecular Properties
| Compound Name | 10-methylindolo[3,2-b]quinoline |
| PubChem CID | 10681089 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 10-methylindolo[3,2-b]quinoline |
| SMILES | Cn1c2ccccc2c2nc3ccccc3cc21 |
| InChI | InChI=1S/C16H12N2/c1-18-14-9-5-3-7-12(14)16-15(18)10-11-6-2-4-8-13(11)17-16/h2-10H,1H3 |
| InChIKey | OKZWKRXLTXEESE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-methylindolo[3,2-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylindolo[3,2-b]quinoline?
The IUPAC name of 10-methylindolo[3,2-b]quinoline (CID 10681089) is 10-methylindolo[3,2-b]quinoline.
What is the SMILES notation for 10-methylindolo[3,2-b]quinoline?
The canonical SMILES for 10-methylindolo[3,2-b]quinoline is Cn1c2ccccc2c2nc3ccccc3cc21.
What is the InChIKey of 10-methylindolo[3,2-b]quinoline?
The InChIKey is OKZWKRXLTXEESE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2/c1-18-14-9-5-3-7-12(14)16-15(18)10-11-6-2-4-8-13(11)17-16/h2-10H,1H3.
What are the key properties of 10-methylindolo[3,2-b]quinoline?
10-methylindolo[3,2-b]quinoline has a molecular weight of 232.29 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylindolo[3,2-b]quinoline is sourced from PubChem (CID 10681089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).