C15H25ClN2OS — CID 106811134
5-[(3-chloro-2-pyridinyl)sulfanyl]-2-ethyl-2-(propylamino)pentan-1-ol (PubChem CID 106811134) has the molecular formula C15H25ClN2OS and a molecular weight of 316.90 g/mol. Its IUPAC name is 5-[(3-chloro-2-pyridinyl)sulfanyl]-2-ethyl-2-(propylamino)pentan-1-ol.
| Compound Name | 5-[(3-chloro-2-pyridinyl)sulfanyl]-2-ethyl-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106811134 |
| Molecular Formula | C15H25ClN2OS |
| Molecular Weight | 316.90 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 5-[(3-chloro-2-pyridinyl)sulfanyl]-2-ethyl-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(CC)(CO)CCCSc1ncccc1Cl |
| InChI | InChI=1S/C15H25ClN2OS/c1-3-9-18-15(4-2,12-19)8-6-11-20-14-13(16)7-5-10-17-14/h5,7,10,18-19H,3-4,6,8-9,11-12H2,1-2H3 |
| InChIKey | AVFKEIUJMNOVNC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.90 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|