About 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol
3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol (PubChem CID 106811441) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol.
Molecular Properties
| Compound Name | 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol |
| PubChem CID | 106811441 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol |
| SMILES | CCC(O)(CN)CCCn1cnc(C)c1C |
| InChI | InChI=1S/C12H23N3O/c1-4-12(16,8-13)6-5-7-15-9-14-10(2)11(15)3/h9,16H,4-8,13H2,1-3H3 |
| InChIKey | DZXOQVBRLKHKED-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol?
The IUPAC name of 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol (CID 106811441) is 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol.
What is the SMILES notation for 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol?
The canonical SMILES for 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol is CCC(O)(CN)CCCn1cnc(C)c1C.
What is the InChIKey of 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol?
The InChIKey is DZXOQVBRLKHKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-4-12(16,8-13)6-5-7-15-9-14-10(2)11(15)3/h9,16H,4-8,13H2,1-3H3.
What are the key properties of 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol?
3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol has a molecular weight of 225.34 g/mol, XLogP of 1.38, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-6-(4,5-dimethylimidazol-1-yl)hexan-3-ol is sourced from PubChem (CID 106811441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).