C16H27NOS — CID 106811664
3-(aminomethyl)-6-[(3,5-dimethylphenyl)methylsulfanyl]hexan-3-ol (PubChem CID 106811664) has the molecular formula C16H27NOS and a molecular weight of 281.47 g/mol. Its IUPAC name is 3-(aminomethyl)-6-[(3,5-dimethylphenyl)methylsulfanyl]hexan-3-ol.
| Compound Name | 3-(aminomethyl)-6-[(3,5-dimethylphenyl)methylsulfanyl]hexan-3-ol |
|---|---|
| PubChem CID | 106811664 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 3-(aminomethyl)-6-[(3,5-dimethylphenyl)methylsulfanyl]hexan-3-ol |
| SMILES | CCC(O)(CN)CCCSCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H27NOS/c1-4-16(18,12-17)6-5-7-19-11-15-9-13(2)8-14(3)10-15/h8-10,18H,4-7,11-12,17H2,1-3H3 |
| InChIKey | BPMHISQLVAWGCR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|