C11H21N3O2 — CID 106814666
(1R)-1-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-3-methylbutan-1-amine (PubChem CID 106814666) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is (1R)-1-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-3-methylbutan-1-amine.
| Compound Name | (1R)-1-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 106814666 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | (1R)-1-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-3-methylbutan-1-amine |
| SMILES | CCOCCc1noc([C@H](N)CC(C)C)n1 |
| InChI | InChI=1S/C11H21N3O2/c1-4-15-6-5-10-13-11(16-14-10)9(12)7-8(2)3/h8-9H,4-7,12H2,1-3H3/t9-/m1/s1 |
| InChIKey | YJICEZDQLJUPAH-SECBINFHSA-N |
| XLogP | 1.69 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|