C8H11BrN2O3 — CID 106814942
5-bromo-2-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 106814942) has the molecular formula C8H11BrN2O3 and a molecular weight of 263.09 g/mol. Its IUPAC name is 5-bromo-2-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 106814942 |
| Molecular Formula | C8H11BrN2O3 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 5-bromo-2-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CCOCCc1nc(O)c(Br)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11BrN2O3/c1-2-14-4-3-5-10-7(12)6(9)8(13)11-5/h2-4H2,1H3,(H2,10,11,12,13) |
| InChIKey | DHLVPDJMBPCAOJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|