C14H13BrCl2N2O — CID 106815034
5-(2-bromophenyl)-4,6-dichloro-2-(2-ethoxyethyl)pyrimidine (PubChem CID 106815034) has the molecular formula C14H13BrCl2N2O and a molecular weight of 376.08 g/mol. Its IUPAC name is 5-(2-bromophenyl)-4,6-dichloro-2-(2-ethoxyethyl)pyrimidine.
| Compound Name | 5-(2-bromophenyl)-4,6-dichloro-2-(2-ethoxyethyl)pyrimidine |
|---|---|
| PubChem CID | 106815034 |
| Molecular Formula | C14H13BrCl2N2O |
| Molecular Weight | 376.08 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 5-(2-bromophenyl)-4,6-dichloro-2-(2-ethoxyethyl)pyrimidine |
| SMILES | CCOCCc1nc(Cl)c(-c2ccccc2Br)c(Cl)n1 |
| InChI | InChI=1S/C14H13BrCl2N2O/c1-2-20-8-7-11-18-13(16)12(14(17)19-11)9-5-3-4-6-10(9)15/h3-6H,2,7-8H2,1H3 |
| InChIKey | WTVFUPABBOXJGJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|