C9H13NO2S — CID 106815106
1-[2-(2-ethoxyethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 106815106) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is 1-[2-(2-ethoxyethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(2-ethoxyethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 106815106 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1-[2-(2-ethoxyethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CCOCCc1ncc(C(C)=O)s1 |
| InChI | InChI=1S/C9H13NO2S/c1-3-12-5-4-9-10-6-8(13-9)7(2)11/h6H,3-5H2,1-2H3 |
| InChIKey | HKOKTVDQEWERBF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|