C16H28N2OS — CID 106815126
2-(2-ethoxyethyl)-5,5-dimethyl-N-propyl-6,7-dihydro-4H-1,3-benzothiazol-7-amine (PubChem CID 106815126) has the molecular formula C16H28N2OS and a molecular weight of 296.48 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-5,5-dimethyl-N-propyl-6,7-dihydro-4H-1,3-benzothiazol-7-amine.
| Compound Name | 2-(2-ethoxyethyl)-5,5-dimethyl-N-propyl-6,7-dihydro-4H-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 106815126 |
| Molecular Formula | C16H28N2OS |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-(2-ethoxyethyl)-5,5-dimethyl-N-propyl-6,7-dihydro-4H-1,3-benzothiazol-7-amine |
| SMILES | CCCNC1CC(C)(C)Cc2nc(CCOCC)sc21 |
| InChI | InChI=1S/C16H28N2OS/c1-5-8-17-12-10-16(3,4)11-13-15(12)20-14(18-13)7-9-19-6-2/h12,17H,5-11H2,1-4H3 |
| InChIKey | CTPUSNLAUKGBMX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|