C11H17NO2S — CID 106815184
2-(2-ethoxyethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol (PubChem CID 106815184) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol.
| Compound Name | 2-(2-ethoxyethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 106815184 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-(2-ethoxyethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
| SMILES | CCOCCc1nc2c(s1)CCCC2O |
| InChI | InChI=1S/C11H17NO2S/c1-2-14-7-6-10-12-11-8(13)4-3-5-9(11)15-10/h8,13H,2-7H2,1H3 |
| InChIKey | FFGITULGYIKXIG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|