About 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine
2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine (PubChem CID 106815188) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine.
Molecular Properties
| Compound Name | 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine |
| PubChem CID | 106815188 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine |
| SMILES | CCOCCc1ncc2c(n1)CC(C)(C)CC2N |
| InChI | InChI=1S/C14H23N3O/c1-4-18-6-5-13-16-9-10-11(15)7-14(2,3)8-12(10)17-13/h9,11H,4-8,15H2,1-3H3 |
| InChIKey | XBDPDLZWNKZQMC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine?
The IUPAC name of 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine (CID 106815188) is 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine.
What is the SMILES notation for 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine?
The canonical SMILES for 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine is CCOCCc1ncc2c(n1)CC(C)(C)CC2N.
What is the InChIKey of 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine?
The InChIKey is XBDPDLZWNKZQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c1-4-18-6-5-13-16-9-10-11(15)7-14(2,3)8-12(10)17-13/h9,11H,4-8,15H2,1-3H3.
What are the key properties of 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine?
2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine has a molecular weight of 249.36 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethyl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine is sourced from PubChem (CID 106815188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).