C11H13N3O3 — CID 106815773
5-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol (PubChem CID 106815773) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol.
| Compound Name | 5-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 106815773 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
| SMILES | CCOCCc1noc(-c2cncc(O)c2)n1 |
| InChI | InChI=1S/C11H13N3O3/c1-2-16-4-3-10-13-11(17-14-10)8-5-9(15)7-12-6-8/h5-7,15H,2-4H2,1H3 |
| InChIKey | PRWCINXXAWLTCJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|