C13H22O4 — CID 10681641
(3R,4aR,7R,8S,8aS)-7,8-dihydroxy-7-methyl-3-propyl-3,4,4a,5,8,8a-hexahydro-1H-isochromen-6-one (PubChem CID 10681641) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (3R,4aR,7R,8S,8aS)-7,8-dihydroxy-7-methyl-3-propyl-3,4,4a,5,8,8a-hexahydro-1H-isochromen-6-one.
| Compound Name | (3R,4aR,7R,8S,8aS)-7,8-dihydroxy-7-methyl-3-propyl-3,4,4a,5,8,8a-hexahydro-1H-isochromen-6-one |
|---|---|
| PubChem CID | 10681641 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3R,4aR,7R,8S,8aS)-7,8-dihydroxy-7-methyl-3-propyl-3,4,4a,5,8,8a-hexahydro-1H-isochromen-6-one |
| SMILES | CCC[C@@H]1C[C@@H]2CC(=O)[C@](C)(O)[C@@H](O)[C@@H]2CO1 |
| InChI | InChI=1S/C13H22O4/c1-3-4-9-5-8-6-11(14)13(2,16)12(15)10(8)7-17-9/h8-10,12,15-16H,3-7H2,1-2H3/t8-,9-,10-,12+,13+/m1/s1 |
| InChIKey | OERJXVQMSIPUQO-JKKYPKHBSA-N |
| XLogP | 0.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |