C11H18ClN3 — CID 106817514
2-(3-chloro-4-methylphenyl)-2-(2,2-dimethylhydrazinyl)ethanamine (PubChem CID 106817514) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-2-(2,2-dimethylhydrazinyl)ethanamine.
| Compound Name | 2-(3-chloro-4-methylphenyl)-2-(2,2-dimethylhydrazinyl)ethanamine |
|---|---|
| PubChem CID | 106817514 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-2-(2,2-dimethylhydrazinyl)ethanamine |
| SMILES | Cc1ccc(C(CN)NN(C)C)cc1Cl |
| InChI | InChI=1S/C11H18ClN3/c1-8-4-5-9(6-10(8)12)11(7-13)14-15(2)3/h4-6,11,14H,7,13H2,1-3H3 |
| InChIKey | YQMMITLJSUGCOB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|