C15H25ClN2O — CID 106818142
2-(3-chloro-4-methylphenyl)-2-[2-(diethylamino)ethylamino]ethanol (PubChem CID 106818142) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-2-[2-(diethylamino)ethylamino]ethanol.
| Compound Name | 2-(3-chloro-4-methylphenyl)-2-[2-(diethylamino)ethylamino]ethanol |
|---|---|
| PubChem CID | 106818142 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-2-[2-(diethylamino)ethylamino]ethanol |
| SMILES | CCN(CC)CCNC(CO)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C15H25ClN2O/c1-4-18(5-2)9-8-17-15(11-19)13-7-6-12(3)14(16)10-13/h6-7,10,15,17,19H,4-5,8-9,11H2,1-3H3 |
| InChIKey | OGSUYNQYKREPGT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |