About methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate
methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate (PubChem CID 1068183) has the molecular formula C17H23NO6S2
and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate |
| PubChem CID | 1068183 |
| Molecular Formula | C17H23NO6S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate |
| SMILES | CCCS(=O)(=O)c1c(S(=O)(=O)CCC)c2c(C)cccn2c1C(=O)OC |
| InChI | InChI=1S/C17H23NO6S2/c1-5-10-25(20,21)15-13-12(3)8-7-9-18(13)14(17(19)24-4)16(15)26(22,23)11-6-2/h7-9H,5-6,10-11H2,1-4H3 |
| InChIKey | ULLNZNLJIPJRFB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 98.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The IUPAC name of methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate (CID 1068183) is methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate.
What is the SMILES notation for methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The canonical SMILES for methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate is CCCS(=O)(=O)c1c(S(=O)(=O)CCC)c2c(C)cccn2c1C(=O)OC.
What is the InChIKey of methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The InChIKey is ULLNZNLJIPJRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO6S2/c1-5-10-25(20,21)15-13-12(3)8-7-9-18(13)14(17(19)24-4)16(15)26(22,23)11-6-2/h7-9H,5-6,10-11H2,1-4H3.
What are the key properties of methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate has a molecular weight of 401.51 g/mol, XLogP of 2.40, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-methyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate is sourced from PubChem (CID 1068183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).