C12H18ClNO2 — CID 106818725
1-(3-chloro-4-methylphenyl)-2-(2-methoxyethylamino)ethanol (PubChem CID 106818725) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-2-(2-methoxyethylamino)ethanol.
| Compound Name | 1-(3-chloro-4-methylphenyl)-2-(2-methoxyethylamino)ethanol |
|---|---|
| PubChem CID | 106818725 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-2-(2-methoxyethylamino)ethanol |
| SMILES | COCCNCC(O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClNO2/c1-9-3-4-10(7-11(9)13)12(15)8-14-5-6-16-2/h3-4,7,12,14-15H,5-6,8H2,1-2H3 |
| InChIKey | LFJNYGILPLZMNW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|